C29H24Br2N4O4 — CID 3077533
2-[[6,8-dibromo-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-4-oxoquinazolin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 3077533) has the molecular formula C29H24Br2N4O4 and a molecular weight of 652.34 g/mol. Its IUPAC name is 2-[[6,8-dibromo-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-4-oxoquinazolin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[6,8-dibromo-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-4-oxoquinazolin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3077533 |
| Molecular Formula | C29H24Br2N4O4 |
| Molecular Weight | 652.34 g/mol |
| Exact Mass | 650.02 |
| IUPAC Name | 2-[[6,8-dibromo-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-4-oxoquinazolin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc2c(Br)cc(Br)cc2c(=O)n1-c1ccc(O)c(CN2CCCCC2)c1 |
| InChI | InChI=1S/C29H24Br2N4O4/c30-18-13-22-26(23(31)14-18)32-25(16-34-27(37)20-6-2-3-7-21(20)28(34)38)35(29(22)39)19-8-9-24(36)17(12-19)15-33-10-4-1-5-11-33/h2-3,6-9,12-14,36H,1,4-5,10-11,15-16H2 |
| InChIKey | ILKABVMRDOVYQU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|