C32H39N5O12 — CID 3077675
2-[2-(3,4,5-trimethoxybenzoyl)oxyethyl-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]ethyl 3,4,5-trimethoxybenzoate (PubChem CID 3077675) has the molecular formula C32H39N5O12 and a molecular weight of 685.69 g/mol. Its IUPAC name is 2-[2-(3,4,5-trimethoxybenzoyl)oxyethyl-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]ethyl 3,4,5-trimethoxybenzoate.
| Compound Name | 2-[2-(3,4,5-trimethoxybenzoyl)oxyethyl-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]ethyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3077675 |
| Molecular Formula | C32H39N5O12 |
| Molecular Weight | 685.69 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | 2-[2-(3,4,5-trimethoxybenzoyl)oxyethyl-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)amino]ethyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCN(CCOC(=O)c2cc(OC)c(OC)c(OC)c2)c2nc3c(c(=O)n(C)c(=O)n3C)n2C)cc(OC)c1OC |
| InChI | InChI=1S/C32H39N5O12/c1-34-24-27(35(2)32(41)36(3)28(24)38)33-31(34)37(10-12-48-29(39)18-14-20(42-4)25(46-8)21(15-18)43-5)11-13-49-30(40)19-16-22(44-6)26(47-9)23(17-19)45-7/h14-17H,10-13H2,1-9H3 |
| InChIKey | FNFKQVXZYYBDCV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 173.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.69 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |