About 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one
2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one (PubChem CID 3077700) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one |
| PubChem CID | 3077700 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one |
| SMILES | CCCCC(=O)c1ccc2c(c1)OC(C)C(=O)N2C |
| InChI | InChI=1S/C15H19NO3/c1-4-5-6-13(17)11-7-8-12-14(9-11)19-10(2)15(18)16(12)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | DCAQJJQCVXMRKY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one?
The IUPAC name of 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one (CID 3077700) is 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one?
The canonical SMILES for 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one is CCCCC(=O)c1ccc2c(c1)OC(C)C(=O)N2C.
What is the InChIKey of 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one?
The InChIKey is DCAQJJQCVXMRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-4-5-6-13(17)11-7-8-12-14(9-11)19-10(2)15(18)16(12)3/h7-10H,4-6H2,1-3H3.
What are the key properties of 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one?
2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one has a molecular weight of 261.32 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-7-pentanoyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 3077700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).