About 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one
2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one (PubChem CID 3077707) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one |
| PubChem CID | 3077707 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one |
| SMILES | C=C(CCC)C(=O)c1ccc2c(c1)OC(C)C(=O)N2C |
| InChI | InChI=1S/C16H19NO3/c1-5-6-10(2)15(18)12-7-8-13-14(9-12)20-11(3)16(19)17(13)4/h7-9,11H,2,5-6H2,1,3-4H3 |
| InChIKey | WKXMVMYUQRBVSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one?
The IUPAC name of 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one (CID 3077707) is 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one.
What is the SMILES notation for 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one?
The canonical SMILES for 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one is C=C(CCC)C(=O)c1ccc2c(c1)OC(C)C(=O)N2C.
What is the InChIKey of 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one?
The InChIKey is WKXMVMYUQRBVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-5-6-10(2)15(18)12-7-8-13-14(9-12)20-11(3)16(19)17(13)4/h7-9,11H,2,5-6H2,1,3-4H3.
What are the key properties of 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one?
2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one has a molecular weight of 273.33 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-7-(2-methylidenepentanoyl)-1,4-benzoxazin-3-one is sourced from PubChem (CID 3077707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).