C16H15N7O3 — CID 3077738
9-methyl-3-(4-nitrophenyl)-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one (PubChem CID 3077738) has the molecular formula C16H15N7O3 and a molecular weight of 353.34 g/mol. Its IUPAC name is 9-methyl-3-(4-nitrophenyl)-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one.
| Compound Name | 9-methyl-3-(4-nitrophenyl)-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one |
|---|---|
| PubChem CID | 3077738 |
| Molecular Formula | C16H15N7O3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 9-methyl-3-(4-nitrophenyl)-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one |
| SMILES | CCCn1c(=O)n2c(-c3ccc([N+](=O)[O-])cc3)nnc2c2c1ncn2C |
| InChI | InChI=1S/C16H15N7O3/c1-3-8-21-14-12(20(2)9-17-14)15-19-18-13(22(15)16(21)24)10-4-6-11(7-5-10)23(25)26/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | IUSPKCFMVOAGNX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 113.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|