C11H14N6O — CID 3077745
3,9-dimethyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one (PubChem CID 3077745) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 3,9-dimethyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one.
| Compound Name | 3,9-dimethyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one |
|---|---|
| PubChem CID | 3077745 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3,9-dimethyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one |
| SMILES | CCCn1c(=O)n2c(C)nnc2c2c1ncn2C |
| InChI | InChI=1S/C11H14N6O/c1-4-5-16-9-8(15(3)6-12-9)10-14-13-7(2)17(10)11(16)18/h6H,4-5H2,1-3H3 |
| InChIKey | FVTULCWPOGTEAN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |