About 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one
9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one (PubChem CID 3077754) has the molecular formula C10H12N6O
and a molecular weight of 232.25 g/mol. Its IUPAC name is 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one.
Molecular Properties
| Compound Name | 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one |
| PubChem CID | 3077754 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one |
| SMILES | CCCn1c(=O)n2cnnc2c2c1ncn2C |
| InChI | InChI=1S/C10H12N6O/c1-3-4-15-8-7(14(2)5-11-8)9-13-12-6-16(9)10(15)17/h5-6H,3-4H2,1-2H3 |
| InChIKey | JHLDKXBWLWVEEJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one?
The IUPAC name of 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one (CID 3077754) is 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one.
What is the SMILES notation for 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one?
The canonical SMILES for 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one is CCCn1c(=O)n2cnnc2c2c1ncn2C.
What is the InChIKey of 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one?
The InChIKey is JHLDKXBWLWVEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6O/c1-3-4-15-8-7(14(2)5-11-8)9-13-12-6-16(9)10(15)17/h5-6H,3-4H2,1-2H3.
What are the key properties of 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one?
9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one has a molecular weight of 232.25 g/mol, XLogP of 0.19, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6-propyl-[1,2,4]triazolo[3,4-f]purin-5-one is sourced from PubChem (CID 3077754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).