About (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate
(3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 30778610) has the molecular formula C21H15FN2O4S
and a molecular weight of 410.43 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 30778610 |
| Molecular Formula | C21H15FN2O4S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCc1cc(-c2ccccc2)no1)c1csc(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H15FN2O4S/c22-15-6-8-16(9-7-15)26-12-20-23-19(13-29-20)21(25)27-11-17-10-18(24-28-17)14-4-2-1-3-5-14/h1-10,13H,11-12H2 |
| InChIKey | JTUYEMAEFAJTIZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate (CID 30778610) is (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate is O=C(OCc1cc(-c2ccccc2)no1)c1csc(COc2ccc(F)cc2)n1.
What is the InChIKey of (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate?
The InChIKey is JTUYEMAEFAJTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15FN2O4S/c22-15-6-8-16(9-7-15)26-12-20-23-19(13-29-20)21(25)27-11-17-10-18(24-28-17)14-4-2-1-3-5-14/h1-10,13H,11-12H2.
What are the key properties of (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate?
(3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate has a molecular weight of 410.43 g/mol, XLogP of 4.87, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-1,2-oxazol-5-yl)methyl 2-[(4-fluorophenoxy)methyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 30778610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).