About 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid
7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid (PubChem CID 3077880) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid |
| PubChem CID | 3077880 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C=C(c1cccnc1)CC2 |
| InChI | InChI=1S/C16H13NO2/c18-16(19)13-6-4-11-3-5-12(8-15(11)9-13)14-2-1-7-17-10-14/h1-2,4,6-10H,3,5H2,(H,18,19) |
| InChIKey | MKFOKAYNCCLXKK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid?
The IUPAC name of 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid (CID 3077880) is 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid?
The canonical SMILES for 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid is O=C(O)c1ccc2c(c1)C=C(c1cccnc1)CC2.
What is the InChIKey of 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid?
The InChIKey is MKFOKAYNCCLXKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c18-16(19)13-6-4-11-3-5-12(8-15(11)9-13)14-2-1-7-17-10-14/h1-2,4,6-10H,3,5H2,(H,18,19).
What are the key properties of 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid?
7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid has a molecular weight of 251.29 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyridin-3-yl-5,6-dihydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 3077880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).