C26H31NO5 — CID 30780574
3-(3,5-dimethoxyphenyl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylpropan-1-one (PubChem CID 30780574) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylpropan-1-one.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylpropan-1-one |
|---|---|
| PubChem CID | 30780574 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylpropan-1-one |
| SMILES | COc1cc(CCC(=O)N2Cc3cc4c(cc3C3(CCCC3)C2)OCCO4)cc(OC)c1 |
| InChI | InChI=1S/C26H31NO5/c1-29-20-11-18(12-21(14-20)30-2)5-6-25(28)27-16-19-13-23-24(32-10-9-31-23)15-22(19)26(17-27)7-3-4-8-26/h11-15H,3-10,16-17H2,1-2H3 |
| InChIKey | MVTJZIHDEYOJSW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |