C25H24N6O2S — CID 30781433
2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile (PubChem CID 30781433) has the molecular formula C25H24N6O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile.
| Compound Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 30781433 |
| Molecular Formula | C25H24N6O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
| SMILES | C=CCn1c(SCC(=O)C(C#N)=C2N(C)c3ccccc3N2C)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C25H24N6O2S/c1-5-14-31-23(17-10-6-9-13-22(17)33-4)27-28-25(31)34-16-21(32)18(15-26)24-29(2)19-11-7-8-12-20(19)30(24)3/h5-13H,1,14,16H2,2-4H3 |
| InChIKey | QTNCGQVAHHFKGJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|