About 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one
5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one (PubChem CID 3078200) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one.
Molecular Properties
| Compound Name | 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one |
| PubChem CID | 3078200 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one |
| SMILES | CCN1C(=O)CCNc2ccccc21 |
| InChI | InChI=1S/C11H14N2O/c1-2-13-10-6-4-3-5-9(10)12-8-7-11(13)14/h3-6,12H,2,7-8H2,1H3 |
| InChIKey | HSZLNPJAFSBTOE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one?
The IUPAC name of 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one (CID 3078200) is 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one.
What is the SMILES notation for 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one?
The canonical SMILES for 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one is CCN1C(=O)CCNc2ccccc21.
What is the InChIKey of 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one?
The InChIKey is HSZLNPJAFSBTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-2-13-10-6-4-3-5-9(10)12-8-7-11(13)14/h3-6,12H,2,7-8H2,1H3.
What are the key properties of 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one?
5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one has a molecular weight of 190.25 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one is sourced from PubChem (CID 3078200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).