C13H18IN — CID 3078228
1,2,3,3-tetramethyl-4H-isoquinolin-2-ium iodide (PubChem CID 3078228) has the molecular formula C13H18IN and a molecular weight of 315.20 g/mol. Its IUPAC name is 1,2,3,3-tetramethyl-4H-isoquinolin-2-ium iodide.
| Compound Name | 1,2,3,3-tetramethyl-4H-isoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 3078228 |
| Molecular Formula | C13H18IN |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1,2,3,3-tetramethyl-4H-isoquinolin-2-ium iodide |
| SMILES | CC1=[N+](C)C(C)(C)Cc2ccccc21.[I-] |
| InChI | InChI=1S/C13H18N.HI/c1-10-12-8-6-5-7-11(12)9-13(2,3)14(10)4;/h5-8H,9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XNMBGURZTNGYGN-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|