About 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride
4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride (PubChem CID 3078397) has the molecular formula C20H21Cl2N3O2
and a molecular weight of 406.31 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride |
| PubChem CID | 3078397 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c(-c2ccc(Cl)cc2)c(CN2CCN(c3ccccc3)CC2)o1 |
| InChI | InChI=1S/C20H20ClN3O2.ClH/c21-16-8-6-15(7-9-16)19-18(26-20(25)22-19)14-23-10-12-24(13-11-23)17-4-2-1-3-5-17;/h1-9H,10-14H2,(H,22,25);1H |
| InChIKey | UNBSYTBQZGLKFC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride?
The IUPAC name of 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride (CID 3078397) is 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride.
What is the SMILES notation for 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride?
The canonical SMILES for 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride is Cl.O=c1[nH]c(-c2ccc(Cl)cc2)c(CN2CCN(c3ccccc3)CC2)o1.
What is the InChIKey of 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride?
The InChIKey is UNBSYTBQZGLKFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClN3O2.ClH/c21-16-8-6-15(7-9-16)19-18(26-20(25)22-19)14-23-10-12-24(13-11-23)17-4-2-1-3-5-17;/h1-9H,10-14H2,(H,22,25);1H.
What are the key properties of 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride?
4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride has a molecular weight of 406.31 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-5-[(4-phenylpiperazin-1-yl)methyl]-3H-1,3-oxazol-2-one;hydrochloride is sourced from PubChem (CID 3078397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).