About ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate
ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 30784001) has the molecular formula C15H29N3O4S
and a molecular weight of 347.48 g/mol. Its IUPAC name is ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate |
| PubChem CID | 30784001 |
| Molecular Formula | C15H29N3O4S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)CC1 |
| InChI | InChI=1S/C15H29N3O4S/c1-4-22-15(19)17-7-5-14(6-8-17)16-23(20,21)18-10-12(2)9-13(3)11-18/h12-14,16H,4-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | QVWAUCZJKMNIAV-STQMWFEESA-N |
| XLogP | 1.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate (CID 30784001) is ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate is CCOC(=O)N1CCC(NS(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)CC1.
What is the InChIKey of ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate?
The InChIKey is QVWAUCZJKMNIAV-STQMWFEESA-N. The full InChI is InChI=1S/C15H29N3O4S/c1-4-22-15(19)17-7-5-14(6-8-17)16-23(20,21)18-10-12(2)9-13(3)11-18/h12-14,16H,4-11H2,1-3H3/t12-,13-/m0/s1.
What are the key properties of ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate?
ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate has a molecular weight of 347.48 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylamino]piperidine-1-carboxylate is sourced from PubChem (CID 30784001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).