About 1,3,3-trimethyl-4H-isoquinoline;hydroiodide
1,3,3-trimethyl-4H-isoquinoline;hydroiodide (PubChem CID 3078429) has the molecular formula C12H16IN
and a molecular weight of 301.17 g/mol. Its IUPAC name is 1,3,3-trimethyl-4H-isoquinoline;hydroiodide.
Molecular Properties
| Compound Name | 1,3,3-trimethyl-4H-isoquinoline;hydroiodide |
| PubChem CID | 3078429 |
| Molecular Formula | C12H16IN |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1,3,3-trimethyl-4H-isoquinoline;hydroiodide |
| SMILES | CC1=NC(C)(C)Cc2ccccc21.I |
| InChI | InChI=1S/C12H15N.HI/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9;/h4-7H,8H2,1-3H3;1H |
| InChIKey | XXWFBNXTPIRWLI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3,3-trimethyl-4H-isoquinoline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,3-trimethyl-4H-isoquinoline;hydroiodide?
The IUPAC name of 1,3,3-trimethyl-4H-isoquinoline;hydroiodide (CID 3078429) is 1,3,3-trimethyl-4H-isoquinoline;hydroiodide.
What is the SMILES notation for 1,3,3-trimethyl-4H-isoquinoline;hydroiodide?
The canonical SMILES for 1,3,3-trimethyl-4H-isoquinoline;hydroiodide is CC1=NC(C)(C)Cc2ccccc21.I.
What is the InChIKey of 1,3,3-trimethyl-4H-isoquinoline;hydroiodide?
The InChIKey is XXWFBNXTPIRWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.HI/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9;/h4-7H,8H2,1-3H3;1H.
What are the key properties of 1,3,3-trimethyl-4H-isoquinoline;hydroiodide?
1,3,3-trimethyl-4H-isoquinoline;hydroiodide has a molecular weight of 301.17 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,3-trimethyl-4H-isoquinoline;hydroiodide is sourced from PubChem (CID 3078429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).