About (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone
(3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone (PubChem CID 3078469) has the molecular formula C15H13N3O
and a molecular weight of 251.29 g/mol. Its IUPAC name is (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone.
Molecular Properties
| Compound Name | (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone |
| PubChem CID | 3078469 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C15H13N3O/c19-15(13-6-9-16-10-7-13)18-14(8-11-17-18)12-4-2-1-3-5-12/h1-7,9-11,14H,8H2 |
| InChIKey | NCNSWABPPPVHPQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone?
The IUPAC name of (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone (CID 3078469) is (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone.
What is the SMILES notation for (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone?
The canonical SMILES for (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone is O=C(c1ccncc1)N1N=CCC1c1ccccc1.
What is the InChIKey of (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone?
The InChIKey is NCNSWABPPPVHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O/c19-15(13-6-9-16-10-7-13)18-14(8-11-17-18)12-4-2-1-3-5-12/h1-7,9-11,14H,8H2.
What are the key properties of (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone?
(3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone has a molecular weight of 251.29 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-3,4-dihydropyrazol-2-yl)-pyridin-4-ylmethanone is sourced from PubChem (CID 3078469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).