C22H24ClN3O2 — CID 30786383
1-(4-chlorophenyl)-5-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]pyrazole-4-carboxamide (PubChem CID 30786383) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 30786383 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCO[C@H](C)c2ccccc2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-16-21(15-25-26(16)20-11-9-19(23)10-12-20)22(27)24-13-6-14-28-17(2)18-7-4-3-5-8-18/h3-5,7-12,15,17H,6,13-14H2,1-2H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | NFVBTAPEIWETNM-QGZVFWFLSA-N |
| XLogP | 4.73 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|