About 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride
7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride (PubChem CID 3078644) has the molecular formula C10H15ClN4O
and a molecular weight of 242.71 g/mol. Its IUPAC name is 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride.
Molecular Properties
| Compound Name | 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride |
| PubChem CID | 3078644 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride |
| SMILES | CC(C)Nc1ncc2c(n1)N(C)C(=O)C2.Cl |
| InChI | InChI=1S/C10H14N4O.ClH/c1-6(2)12-10-11-5-7-4-8(15)14(3)9(7)13-10;/h5-6H,4H2,1-3H3,(H,11,12,13);1H |
| InChIKey | ORUWXXSBRORKSJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
The IUPAC name of 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride (CID 3078644) is 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride.
What is the SMILES notation for 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
The canonical SMILES for 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride is CC(C)Nc1ncc2c(n1)N(C)C(=O)C2.Cl.
What is the InChIKey of 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
The InChIKey is ORUWXXSBRORKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O.ClH/c1-6(2)12-10-11-5-7-4-8(15)14(3)9(7)13-10;/h5-6H,4H2,1-3H3,(H,11,12,13);1H.
What are the key properties of 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride has a molecular weight of 242.71 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-(propan-2-ylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride is sourced from PubChem (CID 3078644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).