C16H27N5O2 — CID 30787115
2-[4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 30787115) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-[4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 30787115 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-[4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(Cc2nc(C(C)(C)C)no2)CC1 |
| InChI | InChI=1S/C16H27N5O2/c1-5-6-17-13(22)11-20-7-9-21(10-8-20)12-14-18-15(19-23-14)16(2,3)4/h5H,1,6-12H2,2-4H3,(H,17,22) |
| InChIKey | FLMOCORRNBWXIG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|