About 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one
4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one (PubChem CID 3078724) has the molecular formula C16H9Cl3IN3O2
and a molecular weight of 508.53 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one |
| PubChem CID | 3078724 |
| Molecular Formula | C16H9Cl3IN3O2 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 506.88 |
| IUPAC Name | 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(OCc2ccc(I)nc2)cnn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H9Cl3IN3O2/c17-11-3-2-10(5-12(11)18)23-16(24)15(19)13(7-22-23)25-8-9-1-4-14(20)21-6-9/h1-7H,8H2 |
| InChIKey | JJGOVOLGDBTXSY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one?
The IUPAC name of 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one (CID 3078724) is 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one.
What is the SMILES notation for 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one?
The canonical SMILES for 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one is O=c1c(Cl)c(OCc2ccc(I)nc2)cnn1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one?
The InChIKey is JJGOVOLGDBTXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl3IN3O2/c17-11-3-2-10(5-12(11)18)23-16(24)15(19)13(7-22-23)25-8-9-1-4-14(20)21-6-9/h1-7H,8H2.
What are the key properties of 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one?
4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one has a molecular weight of 508.53 g/mol, XLogP of 4.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(3,4-dichlorophenyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one is sourced from PubChem (CID 3078724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).