C26H32N2O8 — CID 3078769
2-[5-(1-carboxy-3-methylbutyl)-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]-4-methylpentanoic acid (PubChem CID 3078769) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[5-(1-carboxy-3-methylbutyl)-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]-4-methylpentanoic acid.
| Compound Name | 2-[5-(1-carboxy-3-methylbutyl)-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 3078769 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[5-(1-carboxy-3-methylbutyl)-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C2C3C=CC(C2C1=O)C1C2C(=O)N(C(CC(C)C)C(=O)O)C(=O)C2C31 |
| InChI | InChI=1S/C26H32N2O8/c1-9(2)7-13(25(33)34)27-21(29)17-11-5-6-12(18(17)22(27)30)16-15(11)19-20(16)24(32)28(23(19)31)14(26(35)36)8-10(3)4/h5-6,9-20H,7-8H2,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | YDNBSEBHAIJMNN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|