About N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide
N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 30789724) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide.
Molecular Properties
| Compound Name | N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
| PubChem CID | 30789724 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | CCNC(=O)CCc1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O3/c1-3-11-8(14)5-4-7-6(2)12-10(16)13-9(7)15/h3-5H2,1-2H3,(H,11,14)(H2,12,13,15,16) |
| InChIKey | RBNRMQKJXQMHKB-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide?
The IUPAC name of N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide (CID 30789724) is N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide.
What is the SMILES notation for N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide?
The canonical SMILES for N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide is CCNC(=O)CCc1c(C)[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide?
The InChIKey is RBNRMQKJXQMHKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-3-11-8(14)5-4-7-6(2)12-10(16)13-9(7)15/h3-5H2,1-2H3,(H,11,14)(H2,12,13,15,16).
What are the key properties of N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide?
N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide has a molecular weight of 225.25 g/mol, XLogP of -0.56, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide is sourced from PubChem (CID 30789724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).