C15H20ClNO2 — CID 3079223
[(3S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate;hydrochloride (PubChem CID 3079223) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is [(3S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate;hydrochloride.
| Compound Name | [(3S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate;hydrochloride |
|---|---|
| PubChem CID | 3079223 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [(3S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate;hydrochloride |
| SMILES | Cl.O=C(OC[C@@H]1CC[C@@H]2CCCN21)c1ccccc1 |
| InChI | InChI=1S/C15H19NO2.ClH/c17-15(12-5-2-1-3-6-12)18-11-14-9-8-13-7-4-10-16(13)14;/h1-3,5-6,13-14H,4,7-11H2;1H/t13-,14-;/m0./s1 |
| InChIKey | XZXZXIZTQYHGDZ-IODNYQNNSA-N |
| XLogP | 2.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |