About 3-(2-sulfanylethylamino)propanamide;hydrobromide
3-(2-sulfanylethylamino)propanamide;hydrobromide (PubChem CID 3079261) has the molecular formula C5H13BrN2OS
and a molecular weight of 229.14 g/mol. Its IUPAC name is 3-(2-sulfanylethylamino)propanamide;hydrobromide.
Molecular Properties
| Compound Name | 3-(2-sulfanylethylamino)propanamide;hydrobromide |
| PubChem CID | 3079261 |
| Molecular Formula | C5H13BrN2OS |
| Molecular Weight | 229.14 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 3-(2-sulfanylethylamino)propanamide;hydrobromide |
| SMILES | Br.NC(=O)CCNCCS |
| InChI | InChI=1S/C5H12N2OS.BrH/c6-5(8)1-2-7-3-4-9;/h7,9H,1-4H2,(H2,6,8);1H |
| InChIKey | MTVICJLSZWUMDV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-sulfanylethylamino)propanamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-sulfanylethylamino)propanamide;hydrobromide?
The IUPAC name of 3-(2-sulfanylethylamino)propanamide;hydrobromide (CID 3079261) is 3-(2-sulfanylethylamino)propanamide;hydrobromide.
What is the SMILES notation for 3-(2-sulfanylethylamino)propanamide;hydrobromide?
The canonical SMILES for 3-(2-sulfanylethylamino)propanamide;hydrobromide is Br.NC(=O)CCNCCS.
What is the InChIKey of 3-(2-sulfanylethylamino)propanamide;hydrobromide?
The InChIKey is MTVICJLSZWUMDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2OS.BrH/c6-5(8)1-2-7-3-4-9;/h7,9H,1-4H2,(H2,6,8);1H.
What are the key properties of 3-(2-sulfanylethylamino)propanamide;hydrobromide?
3-(2-sulfanylethylamino)propanamide;hydrobromide has a molecular weight of 229.14 g/mol, XLogP of -0.04, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-sulfanylethylamino)propanamide;hydrobromide is sourced from PubChem (CID 3079261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).