C34H54Cl2N2O4 — CID 3079362
bis[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)butan-2-yl] benzene-1,4-dicarboxylate;dihydrochloride (PubChem CID 3079362) has the molecular formula C34H54Cl2N2O4 and a molecular weight of 625.72 g/mol. Its IUPAC name is bis[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)butan-2-yl] benzene-1,4-dicarboxylate;dihydrochloride.
| Compound Name | bis[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)butan-2-yl] benzene-1,4-dicarboxylate;dihydrochloride |
|---|---|
| PubChem CID | 3079362 |
| Molecular Formula | C34H54Cl2N2O4 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | bis[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)butan-2-yl] benzene-1,4-dicarboxylate;dihydrochloride |
| SMILES | CC(CCC1CC2CCCCC2N1C)OC(=O)c1ccc(C(=O)OC(C)CCC2CC3CCCCC3N2C)cc1.Cl.Cl |
| InChI | InChI=1S/C34H52N2O4.2ClH/c1-23(13-19-29-21-27-9-5-7-11-31(27)35(29)3)39-33(37)25-15-17-26(18-16-25)34(38)40-24(2)14-20-30-22-28-10-6-8-12-32(28)36(30)4;;/h15-18,23-24,27-32H,5-14,19-22H2,1-4H3;2*1H |
| InChIKey | HWZSNVVHOKSWGE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |