About azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate
azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate (PubChem CID 3079423) has the molecular formula C11H17N2O3P
and a molecular weight of 256.24 g/mol. Its IUPAC name is azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate.
Molecular Properties
| Compound Name | azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate |
| PubChem CID | 3079423 |
| Molecular Formula | C11H17N2O3P |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate |
| SMILES | CP(=O)([O-])C1CC(Cc2ccccc2)=NO1.[NH4+] |
| InChI | InChI=1S/C11H14NO3P.H3N/c1-16(13,14)11-8-10(12-15-11)7-9-5-3-2-4-6-9;/h2-6,11H,7-8H2,1H3,(H,13,14);1H3 |
| InChIKey | KQTFLALDINBKHH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate?
The IUPAC name of azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate (CID 3079423) is azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate.
What is the SMILES notation for azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate?
The canonical SMILES for azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate is CP(=O)([O-])C1CC(Cc2ccccc2)=NO1.[NH4+].
What is the InChIKey of azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate?
The InChIKey is KQTFLALDINBKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO3P.H3N/c1-16(13,14)11-8-10(12-15-11)7-9-5-3-2-4-6-9;/h2-6,11H,7-8H2,1H3,(H,13,14);1H3.
What are the key properties of azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate?
azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate has a molecular weight of 256.24 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)-methylphosphinate is sourced from PubChem (CID 3079423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).