C10H11ClNO4P — CID 3079429
[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylphosphonic acid (PubChem CID 3079429) has the molecular formula C10H11ClNO4P and a molecular weight of 275.63 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylphosphonic acid.
| Compound Name | [3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 3079429 |
| Molecular Formula | C10H11ClNO4P |
| Molecular Weight | 275.63 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | [3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)CC1CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C10H11ClNO4P/c11-8-3-1-7(2-4-8)10-5-9(16-12-10)6-17(13,14)15/h1-4,9H,5-6H2,(H2,13,14,15) |
| InChIKey | ABTAVQXRNMOAIM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.63 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|