About (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid
(3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid (PubChem CID 3079439) has the molecular formula C10H12NO4P
and a molecular weight of 241.18 g/mol. Its IUPAC name is (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid.
Molecular Properties
| Compound Name | (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid |
| PubChem CID | 3079439 |
| Molecular Formula | C10H12NO4P |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid |
| SMILES | O=P(O)(O)C1CC(Cc2ccccc2)=NO1 |
| InChI | InChI=1S/C10H12NO4P/c12-16(13,14)10-7-9(11-15-10)6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H2,12,13,14) |
| InChIKey | BWBGRMFFPIKFRF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid?
The IUPAC name of (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid (CID 3079439) is (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid.
What is the SMILES notation for (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid?
The canonical SMILES for (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid is O=P(O)(O)C1CC(Cc2ccccc2)=NO1.
What is the InChIKey of (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid?
The InChIKey is BWBGRMFFPIKFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NO4P/c12-16(13,14)10-7-9(11-15-10)6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H2,12,13,14).
What are the key properties of (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid?
(3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid has a molecular weight of 241.18 g/mol, XLogP of 1.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzyl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid is sourced from PubChem (CID 3079439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).