C19H15FN4O5S — CID 3079456
6-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione (PubChem CID 3079456) has the molecular formula C19H15FN4O5S and a molecular weight of 430.42 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione.
| Compound Name | 6-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione |
|---|---|
| PubChem CID | 3079456 |
| Molecular Formula | C19H15FN4O5S |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 6-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazine-5,7-dione |
| SMILES | COc1cc(-c2nn3c(=O)n(-c4ccc(F)cc4)c(=O)nc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C19H15FN4O5S/c1-27-13-8-10(9-14(28-2)15(13)29-3)16-22-24-18(30-16)21-17(25)23(19(24)26)12-6-4-11(20)5-7-12/h4-9H,1-3H3 |
| InChIKey | DEMJYVAJEQAXDA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |