About N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride
N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride (PubChem CID 3079745) has the molecular formula C19H30Cl2N2
and a molecular weight of 357.37 g/mol. Its IUPAC name is N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride.
Molecular Properties
| Compound Name | N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride |
| PubChem CID | 3079745 |
| Molecular Formula | C19H30Cl2N2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride |
| SMILES | CC1(C)Cc2ccccc2C(CCNC2CCCCC2)=N1.Cl.Cl |
| InChI | InChI=1S/C19H28N2.2ClH/c1-19(2)14-15-8-6-7-11-17(15)18(21-19)12-13-20-16-9-4-3-5-10-16;;/h6-8,11,16,20H,3-5,9-10,12-14H2,1-2H3;2*1H |
| InChIKey | WKMROQFMQLJGLE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride?
The IUPAC name of N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride (CID 3079745) is N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride.
What is the SMILES notation for N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride?
The canonical SMILES for N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride is CC1(C)Cc2ccccc2C(CCNC2CCCCC2)=N1.Cl.Cl.
What is the InChIKey of N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride?
The InChIKey is WKMROQFMQLJGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2.2ClH/c1-19(2)14-15-8-6-7-11-17(15)18(21-19)12-13-20-16-9-4-3-5-10-16;;/h6-8,11,16,20H,3-5,9-10,12-14H2,1-2H3;2*1H.
What are the key properties of N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride?
N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride has a molecular weight of 357.37 g/mol, XLogP of 4.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]cyclohexanamine;dihydrochloride is sourced from PubChem (CID 3079745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).