C15H16Cl2N2O2S — CID 30797762
(1R)-N-(1,3-benzothiazol-2-yl)-2,2-dichloro-N-(2-methoxyethyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 30797762) has the molecular formula C15H16Cl2N2O2S and a molecular weight of 359.28 g/mol. Its IUPAC name is (1R)-N-(1,3-benzothiazol-2-yl)-2,2-dichloro-N-(2-methoxyethyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-(1,3-benzothiazol-2-yl)-2,2-dichloro-N-(2-methoxyethyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 30797762 |
| Molecular Formula | C15H16Cl2N2O2S |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (1R)-N-(1,3-benzothiazol-2-yl)-2,2-dichloro-N-(2-methoxyethyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | COCCN(C(=O)[C@@]1(C)CC1(Cl)Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H16Cl2N2O2S/c1-14(9-15(14,16)17)12(20)19(7-8-21-2)13-18-10-5-3-4-6-11(10)22-13/h3-6H,7-9H2,1-2H3/t14-/m1/s1 |
| InChIKey | VTZIOKSOGTXTBQ-CQSZACIVSA-N |
| XLogP | 3.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|