C14H18BrN5O2S3 — CID 30798027
2-[[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-cyclopropyl-1,2,4-triazole-3-thione (PubChem CID 30798027) has the molecular formula C14H18BrN5O2S3 and a molecular weight of 464.44 g/mol. Its IUPAC name is 2-[[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-cyclopropyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-cyclopropyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 30798027 |
| Molecular Formula | C14H18BrN5O2S3 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 462.98 |
| IUPAC Name | 2-[[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-cyclopropyl-1,2,4-triazole-3-thione |
| SMILES | O=S(=O)(c1ccc(Br)s1)N1CCN(Cn2ncn(C3CC3)c2=S)CC1 |
| InChI | InChI=1S/C14H18BrN5O2S3/c15-12-3-4-13(24-12)25(21,22)18-7-5-17(6-8-18)10-20-14(23)19(9-16-20)11-1-2-11/h3-4,9,11H,1-2,5-8,10H2 |
| InChIKey | ZOWIRGKNBQATMI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|