C30H31N3O3 — CID 30798139
4-[[[2-(dibenzylamino)-2-oxoethyl]-(furan-2-ylmethyl)amino]methyl]-N-methylbenzamide (PubChem CID 30798139) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-[[[2-(dibenzylamino)-2-oxoethyl]-(furan-2-ylmethyl)amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[2-(dibenzylamino)-2-oxoethyl]-(furan-2-ylmethyl)amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 30798139 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 4-[[[2-(dibenzylamino)-2-oxoethyl]-(furan-2-ylmethyl)amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(CC(=O)N(Cc2ccccc2)Cc2ccccc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C30H31N3O3/c1-31-30(35)27-16-14-26(15-17-27)19-32(22-28-13-8-18-36-28)23-29(34)33(20-24-9-4-2-5-10-24)21-25-11-6-3-7-12-25/h2-18H,19-23H2,1H3,(H,31,35) |
| InChIKey | YXKCXBXCXQAGAS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |