About 3-hexylsulfanyl-N'-phenylpropanehydrazide
3-hexylsulfanyl-N'-phenylpropanehydrazide (PubChem CID 3079926) has the molecular formula C15H24N2OS
and a molecular weight of 280.44 g/mol. Its IUPAC name is 3-hexylsulfanyl-N'-phenylpropanehydrazide.
Molecular Properties
| Compound Name | 3-hexylsulfanyl-N'-phenylpropanehydrazide |
| PubChem CID | 3079926 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-hexylsulfanyl-N'-phenylpropanehydrazide |
| SMILES | CCCCCCSCCC(=O)NNc1ccccc1 |
| InChI | InChI=1S/C15H24N2OS/c1-2-3-4-8-12-19-13-11-15(18)17-16-14-9-6-5-7-10-14/h5-7,9-10,16H,2-4,8,11-13H2,1H3,(H,17,18) |
| InChIKey | PPYSQTZKHMAMFK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hexylsulfanyl-N'-phenylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexylsulfanyl-N'-phenylpropanehydrazide?
The IUPAC name of 3-hexylsulfanyl-N'-phenylpropanehydrazide (CID 3079926) is 3-hexylsulfanyl-N'-phenylpropanehydrazide.
What is the SMILES notation for 3-hexylsulfanyl-N'-phenylpropanehydrazide?
The canonical SMILES for 3-hexylsulfanyl-N'-phenylpropanehydrazide is CCCCCCSCCC(=O)NNc1ccccc1.
What is the InChIKey of 3-hexylsulfanyl-N'-phenylpropanehydrazide?
The InChIKey is PPYSQTZKHMAMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2OS/c1-2-3-4-8-12-19-13-11-15(18)17-16-14-9-6-5-7-10-14/h5-7,9-10,16H,2-4,8,11-13H2,1H3,(H,17,18).
What are the key properties of 3-hexylsulfanyl-N'-phenylpropanehydrazide?
3-hexylsulfanyl-N'-phenylpropanehydrazide has a molecular weight of 280.44 g/mol, XLogP of 3.83, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexylsulfanyl-N'-phenylpropanehydrazide is sourced from PubChem (CID 3079926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).