About 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide
4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide (PubChem CID 3080330) has the molecular formula C13H14BrNO2S
and a molecular weight of 328.23 g/mol. Its IUPAC name is 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide.
Molecular Properties
| Compound Name | 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide |
| PubChem CID | 3080330 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide |
| SMILES | Br.NCc1ccccc1Sc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H13NO2S.BrH/c14-8-9-3-1-2-4-13(9)17-10-5-6-11(15)12(16)7-10;/h1-7,15-16H,8,14H2;1H |
| InChIKey | LKAYUBYPKNZUSM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide?
The IUPAC name of 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide (CID 3080330) is 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide.
What is the SMILES notation for 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide?
The canonical SMILES for 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide is Br.NCc1ccccc1Sc1ccc(O)c(O)c1.
What is the InChIKey of 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide?
The InChIKey is LKAYUBYPKNZUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2S.BrH/c14-8-9-3-1-2-4-13(9)17-10-5-6-11(15)12(16)7-10;/h1-7,15-16H,8,14H2;1H.
What are the key properties of 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide?
4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide has a molecular weight of 328.23 g/mol, XLogP of 3.29, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(aminomethyl)phenyl]sulfanylbenzene-1,2-diol;hydrobromide is sourced from PubChem (CID 3080330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).