About N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide
N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide (PubChem CID 3080433) has the molecular formula C21H25F2N3O3
and a molecular weight of 405.45 g/mol. Its IUPAC name is N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide.
Molecular Properties
| Compound Name | N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide |
| PubChem CID | 3080433 |
| Molecular Formula | C21H25F2N3O3 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide |
| SMILES | CCN(CC)C(C)C(=O)NNC(=O)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25F2N3O3/c1-4-26(5-2)14(3)19(27)24-25-20(28)21(29,15-6-10-17(22)11-7-15)16-8-12-18(23)13-9-16/h6-14,29H,4-5H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | RUTAEVOJVUQLTQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide?
The IUPAC name of N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide (CID 3080433) is N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide.
What is the SMILES notation for N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide?
The canonical SMILES for N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide is CCN(CC)C(C)C(=O)NNC(=O)C(O)(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide?
The InChIKey is RUTAEVOJVUQLTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2N3O3/c1-4-26(5-2)14(3)19(27)24-25-20(28)21(29,15-6-10-17(22)11-7-15)16-8-12-18(23)13-9-16/h6-14,29H,4-5H2,1-3H3,(H,24,27)(H,25,28).
What are the key properties of N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide?
N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide has a molecular weight of 405.45 g/mol, XLogP of 2.08, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]-2-(diethylamino)propanehydrazide is sourced from PubChem (CID 3080433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).