C16H26Cl2N4S — CID 3080435
N',N'-dimethyl-N-[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]propane-1,3-diamine;dihydrochloride (PubChem CID 3080435) has the molecular formula C16H26Cl2N4S and a molecular weight of 377.39 g/mol. Its IUPAC name is N',N'-dimethyl-N-[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dimethyl-N-[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 3080435 |
| Molecular Formula | C16H26Cl2N4S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N',N'-dimethyl-N-[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]propane-1,3-diamine;dihydrochloride |
| SMILES | Cc1cc(C)c(-c2nnc(NCCCN(C)C)s2)c(C)c1.Cl.Cl |
| InChI | InChI=1S/C16H24N4S.2ClH/c1-11-9-12(2)14(13(3)10-11)15-18-19-16(21-15)17-7-6-8-20(4)5;;/h9-10H,6-8H2,1-5H3,(H,17,19);2*1H |
| InChIKey | OYNPTEZOFXNYRE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|