About 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 3080454) has the molecular formula C7H10N2OS
and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 3080454 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | CS(=O)c1cn2c(n1)CCC2 |
| InChI | InChI=1S/C7H10N2OS/c1-11(10)7-5-9-4-2-3-6(9)8-7/h5H,2-4H2,1H3 |
| InChIKey | XJDSACWUCWIGEB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 3080454) is 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is CS(=O)c1cn2c(n1)CCC2.
What is the InChIKey of 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is XJDSACWUCWIGEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS/c1-11(10)7-5-9-4-2-3-6(9)8-7/h5H,2-4H2,1H3.
What are the key properties of 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 170.24 g/mol, XLogP of 0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfinyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 3080454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).