C23H24ClN3O4 — CID 30804674
(E)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3,5-dimethoxyphenyl)-N-propan-2-ylprop-2-enamide (PubChem CID 30804674) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is (E)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3,5-dimethoxyphenyl)-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3,5-dimethoxyphenyl)-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 30804674 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (E)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-(3,5-dimethoxyphenyl)-N-propan-2-ylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(Cc2nnc(-c3ccc(Cl)cc3)o2)C(C)C)cc(OC)c1 |
| InChI | InChI=1S/C23H24ClN3O4/c1-15(2)27(14-21-25-26-23(31-21)17-6-8-18(24)9-7-17)22(28)10-5-16-11-19(29-3)13-20(12-16)30-4/h5-13,15H,14H2,1-4H3/b10-5+ |
| InChIKey | MCAHSQIVOOSQDA-BJMVGYQFSA-N |
| XLogP | 4.86 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|