2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid

C10H9NO3 — CID 3080590

IUPAC2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid
SMILESO=C(O)CC1C(=O)Nc2ccccc21
InChIInChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13)
InChIKeyILGMGHZPXRDCCS-UHFFFAOYSA-N
MW191.19 g/mol
LogP1.20
Rot. Bonds2

About 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid

2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid (PubChem CID 3080590) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid
PubChem CID3080590
Molecular FormulaC10H9NO3
Molecular Weight191.19 g/mol
Exact Mass191.06
IUPAC Name2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid
SMILESO=C(O)CC1C(=O)Nc2ccccc21
InChIInChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13)
InChIKeyILGMGHZPXRDCCS-UHFFFAOYSA-N
XLogP1.20
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.19
LogP ≤ 51.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid?
The IUPAC name of 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid (CID 3080590) is 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid.
What is the SMILES notation for 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid?
The canonical SMILES for 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid is O=C(O)CC1C(=O)Nc2ccccc21.
What is the InChIKey of 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid?
The InChIKey is ILGMGHZPXRDCCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13).
What are the key properties of 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid?
2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid has a molecular weight of 191.19 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1,3-dihydroindol-3-yl)acetic acid is sourced from PubChem (CID 3080590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).