About 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol
4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol (PubChem CID 3080596) has the molecular formula C14H11I4NO2
and a molecular weight of 732.86 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol.
Molecular Properties
| Compound Name | 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol |
| PubChem CID | 3080596 |
| Molecular Formula | C14H11I4NO2 |
| Molecular Weight | 732.86 g/mol |
| Exact Mass | 732.70 |
| IUPAC Name | 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol |
| SMILES | NCCc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C14H11I4NO2/c15-9-5-8(6-10(16)13(9)20)21-14-11(17)3-7(1-2-19)4-12(14)18/h3-6,20H,1-2,19H2 |
| InChIKey | NMRKJTPVKAFIII-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 732.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol?
The IUPAC name of 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol (CID 3080596) is 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol.
What is the SMILES notation for 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol?
The canonical SMILES for 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol is NCCc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1.
What is the InChIKey of 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol?
The InChIKey is NMRKJTPVKAFIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11I4NO2/c15-9-5-8(6-10(16)13(9)20)21-14-11(17)3-7(1-2-19)4-12(14)18/h3-6,20H,1-2,19H2.
What are the key properties of 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol?
4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol has a molecular weight of 732.86 g/mol, XLogP of 5.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2,6-diiodophenol is sourced from PubChem (CID 3080596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).