C25H24F4N4O2 — CID 30806385
1-(4-fluorophenyl)-N-methyl-N-[[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 30806385) has the molecular formula C25H24F4N4O2 and a molecular weight of 488.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methyl-N-[[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-methyl-N-[[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 30806385 |
| Molecular Formula | C25H24F4N4O2 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methyl-N-[[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CN(Cc1ccc(C(=O)NCC(F)(F)F)cc1)C(=O)c1nn(-c2ccc(F)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C25H24F4N4O2/c1-32(14-16-6-8-17(9-7-16)23(34)30-15-25(27,28)29)24(35)22-20-4-2-3-5-21(20)33(31-22)19-12-10-18(26)11-13-19/h6-13H,2-5,14-15H2,1H3,(H,30,34) |
| InChIKey | TZSLAOLCBMHQJS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |