C25H18O9 — CID 3080647
4,9-dimethoxyfuro[3,2-g]chromen-7-one;4-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 3080647) has the molecular formula C25H18O9 and a molecular weight of 462.41 g/mol. Its IUPAC name is 4,9-dimethoxyfuro[3,2-g]chromen-7-one;4-methoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 4,9-dimethoxyfuro[3,2-g]chromen-7-one;4-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 3080647 |
| Molecular Formula | C25H18O9 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4,9-dimethoxyfuro[3,2-g]chromen-7-one;4-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2ccoc2c(OC)c2oc(=O)ccc12.COc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C13H10O5.C12H8O4/c1-15-10-7-3-4-9(14)18-12(7)13(16-2)11-8(10)5-6-17-11;1-14-12-7-2-3-11(13)16-10(7)6-9-8(12)4-5-15-9/h3-6H,1-2H3;2-6H,1H3 |
| InChIKey | GIQRBVVYHBZHIU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 114.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|