About Tempo carboxylic acid
Tempo carboxylic acid (PubChem CID 3080786) has the molecular formula C10H18NO3
and a molecular weight of 200.26 g/mol.
Molecular Properties
| Compound Name | Tempo carboxylic acid |
| PubChem CID | 3080786 |
| Molecular Formula | C10H18NO3 |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(C(=O)O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C10H18NO3/c1-9(2)5-7(8(12)13)6-10(3,4)11(9)14/h7H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | CYQGCJQJIOARKD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Tempo carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tempo carboxylic acid?
The IUPAC name of Tempo carboxylic acid (CID 3080786) is not available.
What is the SMILES notation for Tempo carboxylic acid?
The canonical SMILES for Tempo carboxylic acid is CC1(C)CC(C(=O)O)CC(C)(C)N1[O].
What is the InChIKey of Tempo carboxylic acid?
The InChIKey is CYQGCJQJIOARKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18NO3/c1-9(2)5-7(8(12)13)6-10(3,4)11(9)14/h7H,5-6H2,1-4H3,(H,12,13).
What are the key properties of Tempo carboxylic acid?
Tempo carboxylic acid has a molecular weight of 200.26 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Tempo carboxylic acid is sourced from PubChem (CID 3080786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).