C20H26N6O6S — CID 30808078
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]ethanesulfonamide (PubChem CID 30808078) has the molecular formula C20H26N6O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]ethanesulfonamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 30808078 |
| Molecular Formula | C20H26N6O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-[2-[(4S)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]ethanesulfonamide |
| SMILES | Cc1nn(CCS(=O)(=O)N(C)CC(=O)N2c3ccccc3NC(=O)C[C@@H]2C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N6O6S/c1-13-11-18(27)21-16-7-5-6-8-17(16)25(13)19(28)12-23(4)33(31,32)10-9-24-15(3)20(26(29)30)14(2)22-24/h5-8,13H,9-12H2,1-4H3,(H,21,27)/t13-/m0/s1 |
| InChIKey | DIUBIJAVUWMWIV-ZDUSSCGKSA-N |
| XLogP | 1.43 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|