About 2-oct-2-enylbutanedioic acid
2-oct-2-enylbutanedioic acid (PubChem CID 3080890) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-oct-2-enylbutanedioic acid.
Molecular Properties
| Compound Name | 2-oct-2-enylbutanedioic acid |
| PubChem CID | 3080890 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-oct-2-enylbutanedioic acid |
| SMILES | CCCCCC=CCC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20O4/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14/h6-7,10H,2-5,8-9H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | QWBQTFQCJMOSPK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-oct-2-enylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oct-2-enylbutanedioic acid?
The IUPAC name of 2-oct-2-enylbutanedioic acid (CID 3080890) is 2-oct-2-enylbutanedioic acid.
What is the SMILES notation for 2-oct-2-enylbutanedioic acid?
The canonical SMILES for 2-oct-2-enylbutanedioic acid is CCCCCC=CCC(CC(=O)O)C(=O)O.
What is the InChIKey of 2-oct-2-enylbutanedioic acid?
The InChIKey is QWBQTFQCJMOSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14/h6-7,10H,2-5,8-9H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 2-oct-2-enylbutanedioic acid?
2-oct-2-enylbutanedioic acid has a molecular weight of 228.29 g/mol, XLogP of 2.69, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oct-2-enylbutanedioic acid is sourced from PubChem (CID 3080890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).