2-oct-2-enylbutanedioic acid

C12H20O4 — CID 3080890

IUPAC2-oct-2-enylbutanedioic acid
SMILESCCCCCC=CCC(CC(=O)O)C(=O)O
InChIInChI=1S/C12H20O4/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14/h6-7,10H,2-5,8-9H2,1H3,(H,13,14)(H,15,16)
InChIKeyQWBQTFQCJMOSPK-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.69
Rot. Bonds9

About 2-oct-2-enylbutanedioic acid

2-oct-2-enylbutanedioic acid (PubChem CID 3080890) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-oct-2-enylbutanedioic acid.

Molecular Properties

Compound Name2-oct-2-enylbutanedioic acid
PubChem CID3080890
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name2-oct-2-enylbutanedioic acid
SMILESCCCCCC=CCC(CC(=O)O)C(=O)O
InChIInChI=1S/C12H20O4/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14/h6-7,10H,2-5,8-9H2,1H3,(H,13,14)(H,15,16)
InChIKeyQWBQTFQCJMOSPK-UHFFFAOYSA-N
XLogP2.69
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-oct-2-enylbutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oct-2-enylbutanedioic acid?
The IUPAC name of 2-oct-2-enylbutanedioic acid (CID 3080890) is 2-oct-2-enylbutanedioic acid.
What is the SMILES notation for 2-oct-2-enylbutanedioic acid?
The canonical SMILES for 2-oct-2-enylbutanedioic acid is CCCCCC=CCC(CC(=O)O)C(=O)O.
What is the InChIKey of 2-oct-2-enylbutanedioic acid?
The InChIKey is QWBQTFQCJMOSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14/h6-7,10H,2-5,8-9H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 2-oct-2-enylbutanedioic acid?
2-oct-2-enylbutanedioic acid has a molecular weight of 228.29 g/mol, XLogP of 2.69, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oct-2-enylbutanedioic acid is sourced from PubChem (CID 3080890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).