About 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole
2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole (PubChem CID 3080926) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 3080926 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc2oc(C3=NCCN3)cc2c1 |
| InChI | InChI=1S/C11H10N2O/c1-2-4-9-8(3-1)7-10(14-9)11-12-5-6-13-11/h1-4,7H,5-6H2,(H,12,13) |
| InChIKey | YTJOHEUHUVBKSB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole (CID 3080926) is 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole is c1ccc2oc(C3=NCCN3)cc2c1.
What is the InChIKey of 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole?
The InChIKey is YTJOHEUHUVBKSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c1-2-4-9-8(3-1)7-10(14-9)11-12-5-6-13-11/h1-4,7H,5-6H2,(H,12,13).
What are the key properties of 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole?
2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole has a molecular weight of 186.21 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 3080926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).