About methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride
methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride (PubChem CID 3080940) has the molecular formula C9H13FO3
and a molecular weight of 188.20 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride |
| PubChem CID | 3080940 |
| Molecular Formula | C9H13FO3 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride |
| SMILES | C=C(C)C(=O)F.C=C(C)C(=O)OC |
| InChI | InChI=1S/C5H8O2.C4H5FO/c1-4(2)5(6)7-3;1-3(2)4(5)6/h1H2,2-3H3;1H2,2H3 |
| InChIKey | RYIBNIWOXVFZGD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride?
The IUPAC name of methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride (CID 3080940) is methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride.
What is the SMILES notation for methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride?
The canonical SMILES for methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride is C=C(C)C(=O)F.C=C(C)C(=O)OC.
What is the InChIKey of methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride?
The InChIKey is RYIBNIWOXVFZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H5FO/c1-4(2)5(6)7-3;1-3(2)4(5)6/h1H2,2-3H3;1H2,2H3.
What are the key properties of methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride?
methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride has a molecular weight of 188.20 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;2-methylprop-2-enoyl fluoride is sourced from PubChem (CID 3080940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).