About 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline
4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline (PubChem CID 3081066) has the molecular formula C18H32NO3P
and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline.
Molecular Properties
| Compound Name | 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline |
| PubChem CID | 3081066 |
| Molecular Formula | C18H32NO3P |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline |
| SMILES | CC(OP(=O)(OC(C)C(C)(C)C)c1ccc(N)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H32NO3P/c1-13(17(3,4)5)21-23(20,22-14(2)18(6,7)8)16-11-9-15(19)10-12-16/h9-14H,19H2,1-8H3 |
| InChIKey | JYWMAJMLMKHXQU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline?
The IUPAC name of 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline (CID 3081066) is 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline.
What is the SMILES notation for 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline?
The canonical SMILES for 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline is CC(OP(=O)(OC(C)C(C)(C)C)c1ccc(N)cc1)C(C)(C)C.
What is the InChIKey of 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline?
The InChIKey is JYWMAJMLMKHXQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32NO3P/c1-13(17(3,4)5)21-23(20,22-14(2)18(6,7)8)16-11-9-15(19)10-12-16/h9-14H,19H2,1-8H3.
What are the key properties of 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline?
4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline has a molecular weight of 341.43 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(3,3-dimethylbutan-2-yloxy)phosphoryl]aniline is sourced from PubChem (CID 3081066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).